C21H22ClN3O3 — CID 30378582
1-(4-chlorophenyl)-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea (PubChem CID 30378582) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea |
|---|---|
| PubChem CID | 30378582 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,3-dimethyl-4-oxo-5-prop-2-enyl-2H-1,5-benzoxazepin-7-yl)urea |
| SMILES | C=CCN1C(=O)C(C)(C)COc2ccc(NC(=O)Nc3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C21H22ClN3O3/c1-4-11-25-17-12-16(9-10-18(17)28-13-21(2,3)19(25)26)24-20(27)23-15-7-5-14(22)6-8-15/h4-10,12H,1,11,13H2,2-3H3,(H2,23,24,27) |
| InChIKey | DIZLUWSCEUIKHV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|