C17H13N3O5S2 — CID 40888296
7-methoxy-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)-1-benzofuran-2-carboxamide (PubChem CID 40888296) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 7-methoxy-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40888296 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 7-methoxy-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3nc4ccc(S(N)(=O)=O)cc4s3)oc12 |
| InChI | InChI=1S/C17H13N3O5S2/c1-24-12-4-2-3-9-7-13(25-15(9)12)16(21)20-17-19-11-6-5-10(27(18,22)23)8-14(11)26-17/h2-8H,1H3,(H2,18,22,23)(H,19,20,21) |
| InChIKey | KLCZAPIJQDJVJH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |