C22H19N3O6S — CID 40889384
N-(3,5-dimethyl-6-oxobenzo[b][1,4]benzoxazepin-8-yl)-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 40889384) has the molecular formula C22H19N3O6S and a molecular weight of 453.48 g/mol. Its IUPAC name is N-(3,5-dimethyl-6-oxobenzo[b][1,4]benzoxazepin-8-yl)-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3,5-dimethyl-6-oxobenzo[b][1,4]benzoxazepin-8-yl)-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40889384 |
| Molecular Formula | C22H19N3O6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-(3,5-dimethyl-6-oxobenzo[b][1,4]benzoxazepin-8-yl)-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)c1cc(NS(=O)(=O)c3cc([N+](=O)[O-])ccc3C)ccc1O2 |
| InChI | InChI=1S/C22H19N3O6S/c1-13-4-8-20-18(10-13)24(3)22(26)17-11-15(6-9-19(17)31-20)23-32(29,30)21-12-16(25(27)28)7-5-14(21)2/h4-12,23H,1-3H3 |
| InChIKey | ASRJQTOHLSXPQW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|