C15H13N2O7S- — CID 4088975
4-methoxy-3-[(2-methyl-5-nitrophenyl)sulfamoyl]benzoate (PubChem CID 4088975) has the molecular formula C15H13N2O7S- and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-methoxy-3-[(2-methyl-5-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | 4-methoxy-3-[(2-methyl-5-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4088975 |
| Molecular Formula | C15H13N2O7S- |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-methoxy-3-[(2-methyl-5-nitrophenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)[O-])cc1S(=O)(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C15H14N2O7S/c1-9-3-5-11(17(20)21)8-12(9)16-25(22,23)14-7-10(15(18)19)4-6-13(14)24-2/h3-8,16H,1-2H3,(H,18,19)/p-1 |
| InChIKey | QIBYCNOVQSWUHR-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|