C14H9F3N4 — CID 4089119
11-(trifluoromethyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene (PubChem CID 4089119) has the molecular formula C14H9F3N4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 11-(trifluoromethyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene.
| Compound Name | 11-(trifluoromethyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene |
|---|---|
| PubChem CID | 4089119 |
| Molecular Formula | C14H9F3N4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 11-(trifluoromethyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene |
| SMILES | FC(F)(F)c1c2c(nc3ncnn13)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H9F3N4/c15-14(16,17)12-10-6-5-8-3-1-2-4-9(8)11(10)20-13-18-7-19-21(12)13/h1-4,7H,5-6H2 |
| InChIKey | DVFYFLAJLXCYFI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |