C25H29N3O5S — CID 40891662
2-[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylacetamide (PubChem CID 40891662) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylacetamide.
| Compound Name | 2-[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 40891662 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethylacetamide |
| SMILES | CCN(C(=O)CN1C(=O)N[C@@](c2ccccc2)(c2ccc(C)c(C)c2)C1=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H29N3O5S/c1-4-27(21-12-13-34(32,33)16-21)22(29)15-28-23(30)25(26-24(28)31,19-8-6-5-7-9-19)20-11-10-17(2)18(3)14-20/h5-11,14,21H,4,12-13,15-16H2,1-3H3,(H,26,31)/t21-,25-/m0/s1 |
| InChIKey | SUAQWEITONNLQL-OFVILXPXSA-N |
| XLogP | 2.13 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|