C15H18ClN3O3S — CID 40895375
N-[(4-chlorophenyl)methyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40895375) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40895375 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CSCC[C@H]1NC(=O)N(CC(=O)NCc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C15H18ClN3O3S/c1-23-7-6-12-14(21)19(15(22)18-12)9-13(20)17-8-10-2-4-11(16)5-3-10/h2-5,12H,6-9H2,1H3,(H,17,20)(H,18,22)/t12-/m1/s1 |
| InChIKey | XBNXNXVJXZSRKA-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|