C24H19ClN4O3 — CID 40895481
(5R)-3-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 40895481) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is (5R)-3-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40895481 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (5R)-3-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccco2)NC(=O)N(Cc2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H19ClN4O3/c1-24(20-8-5-13-32-20)22(30)28(23(31)26-24)14-17-15-29(19-6-3-2-4-7-19)27-21(17)16-9-11-18(25)12-10-16/h2-13,15H,14H2,1H3,(H,26,31)/t24-/m1/s1 |
| InChIKey | MGKSOJYBEVUEKQ-XMMPIXPASA-N |
| XLogP | 4.75 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|