C27H22N4O4 — CID 27723530
(5R)-5-(1,3-benzodioxol-5-yl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 27723530) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-yl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-yl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 27723530 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-yl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc3c(c2)OCO3)NC(=O)N(Cc2cn(-c3ccccc3)nc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C27H22N4O4/c1-27(20-12-13-22-23(14-20)35-17-34-22)25(32)30(26(33)28-27)15-19-16-31(21-10-6-3-7-11-21)29-24(19)18-8-4-2-5-9-18/h2-14,16H,15,17H2,1H3,(H,28,33)/t27-/m1/s1 |
| InChIKey | RGSQJIZCNZPSKV-HHHXNRCGSA-N |
| XLogP | 4.24 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|