C23H24N3O4+ — CID 7832864
(5R)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]imidazolidine-2,4-dione (PubChem CID 7832864) has the molecular formula C23H24N3O4+ and a molecular weight of 406.46 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7832864 |
| Molecular Formula | C23H24N3O4+ |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc3c(c2)OCO3)NC(=O)N(C[NH+]2CC=C(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H23N3O4/c1-23(18-7-8-19-20(13-18)30-15-29-19)21(27)26(22(28)24-23)14-25-11-9-17(10-12-25)16-5-3-2-4-6-16/h2-9,13H,10-12,14-15H2,1H3,(H,24,28)/p+1/t23-/m1/s1 |
| InChIKey | JCAOHKYXKURIED-HSZRJFAPSA-O |
| XLogP | 1.51 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|