C29H26F2N2O3S — CID 4089868
3-[benzyl(2-phenylethyl)sulfamoyl]-4-fluoro-N-(3-fluoro-4-methylphenyl)benzamide (PubChem CID 4089868) has the molecular formula C29H26F2N2O3S and a molecular weight of 520.60 g/mol. Its IUPAC name is 3-[benzyl(2-phenylethyl)sulfamoyl]-4-fluoro-N-(3-fluoro-4-methylphenyl)benzamide.
| Compound Name | 3-[benzyl(2-phenylethyl)sulfamoyl]-4-fluoro-N-(3-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 4089868 |
| Molecular Formula | C29H26F2N2O3S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 3-[benzyl(2-phenylethyl)sulfamoyl]-4-fluoro-N-(3-fluoro-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(F)c(S(=O)(=O)N(CCc3ccccc3)Cc3ccccc3)c2)cc1F |
| InChI | InChI=1S/C29H26F2N2O3S/c1-21-12-14-25(19-27(21)31)32-29(34)24-13-15-26(30)28(18-24)37(35,36)33(20-23-10-6-3-7-11-23)17-16-22-8-4-2-5-9-22/h2-15,18-19H,16-17,20H2,1H3,(H,32,34) |
| InChIKey | XMBPREXXKOCWLL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |