C23H25N3O4S3 — CID 40903374
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[(7R)-7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 40903374) has the molecular formula C23H25N3O4S3 and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[(7R)-7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[(7R)-7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 40903374 |
| Molecular Formula | C23H25N3O4S3 |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[(7R)-7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]1CCc2c(sc3nc(SCC(=O)N[C@H]4CCS(=O)(=O)C4)n(-c4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C23H25N3O4S3/c1-14-7-8-17-18(11-14)32-21-20(17)22(28)26(16-5-3-2-4-6-16)23(25-21)31-12-19(27)24-15-9-10-33(29,30)13-15/h2-6,14-15H,7-13H2,1H3,(H,24,27)/t14-,15+/m1/s1 |
| InChIKey | JWIGEQIKEZAQMW-CABCVRRESA-N |
| XLogP | 2.97 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |