C30H31N3O6 — CID 40909886
(5R)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 40909886) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is (5R)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40909886 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (5R)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(OCc2ccccc2)ccc1C(O)=C1C(=O)C(=O)N(CCCN(C)C)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H31N3O6/c1-20-18-24(39-19-21-8-5-4-6-9-21)14-15-25(20)28(34)26-27(22-10-12-23(13-11-22)33(37)38)32(30(36)29(26)35)17-7-16-31(2)3/h4-6,8-15,18,27,34H,7,16-17,19H2,1-3H3/t27-/m1/s1 |
| InChIKey | HTNAPMCPODMODL-HHHXNRCGSA-N |
| XLogP | 4.86 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|