C19H16BrNO4S — CID 40913874
2-[2-(5-bromo-1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide (PubChem CID 40913874) has the molecular formula C19H16BrNO4S and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-[2-(5-bromo-1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(5-bromo-1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 40913874 |
| Molecular Formula | C19H16BrNO4S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 2-[2-(5-bromo-1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSCC(=O)c2cc3cc(Br)ccc3o2)cc1 |
| InChI | InChI=1S/C19H16BrNO4S/c1-24-15-5-3-14(4-6-15)21-19(23)11-26-10-16(22)18-9-12-8-13(20)2-7-17(12)25-18/h2-9H,10-11H2,1H3,(H,21,23) |
| InChIKey | PEPZVAVMLPAIBH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |