C23H24Cl2N2O3 — CID 40915875
(5R,10bS)-2-(3,4-dichlorophenyl)-7-methoxy-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] (PubChem CID 40915875) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is (5R,10bS)-2-(3,4-dichlorophenyl)-7-methoxy-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane].
| Compound Name | (5R,10bS)-2-(3,4-dichlorophenyl)-7-methoxy-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
|---|---|
| PubChem CID | 40915875 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (5R,10bS)-2-(3,4-dichlorophenyl)-7-methoxy-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
| SMILES | COc1cccc2c1O[C@@]1(CCOC(C)(C)C1)N1N=C(c3ccc(Cl)c(Cl)c3)C[C@@H]21 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-22(2)13-23(9-10-29-22)27-19(15-5-4-6-20(28-3)21(15)30-23)12-18(26-27)14-7-8-16(24)17(25)11-14/h4-8,11,19H,9-10,12-13H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | WENAUEXWDPYYJE-WMZHIEFXSA-N |
| XLogP | 5.83 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |