C24H26N2O4 — CID 25426332
(5R,10bR)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] (PubChem CID 25426332) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (5R,10bR)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane].
| Compound Name | (5R,10bR)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
|---|---|
| PubChem CID | 25426332 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (5R,10bR)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
| SMILES | CC1(C)C[C@@]2(CCO1)Oc1ccccc1[C@H]1CC(c3ccc4c(c3)OCCO4)=NN12 |
| InChI | InChI=1S/C24H26N2O4/c1-23(2)15-24(9-10-29-23)26-19(17-5-3-4-6-20(17)30-24)14-18(25-26)16-7-8-21-22(13-16)28-12-11-27-21/h3-8,13,19H,9-12,14-15H2,1-2H3/t19-,24-/m1/s1 |
| InChIKey | NMOOFXKNAGMTFR-NTKDMRAZSA-N |
| XLogP | 4.29 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |