C24H28N2O2 — CID 4669095
2-(2,5-dimethylphenyl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] (PubChem CID 4669095) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane].
| Compound Name | 2-(2,5-dimethylphenyl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
|---|---|
| PubChem CID | 4669095 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-2',2'-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-oxane] |
| SMILES | Cc1ccc(C)c(C2=NN3C(C2)c2ccccc2OC32CCOC(C)(C)C2)c1 |
| InChI | InChI=1S/C24H28N2O2/c1-16-9-10-17(2)19(13-16)20-14-21-18-7-5-6-8-22(18)28-24(26(21)25-20)11-12-27-23(3,4)15-24/h5-10,13,21H,11-12,14-15H2,1-4H3 |
| InChIKey | VJRVLQLMFWKVHW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |