C16H20N2O3S2 — CID 40917858
(2S)-N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenylbutanamide (PubChem CID 40917858) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2S)-N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenylbutanamide.
| Compound Name | (2S)-N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenylbutanamide |
|---|---|
| PubChem CID | 40917858 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2S)-N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenylbutanamide |
| SMILES | CC[C@H](C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1C)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-3-12(11-7-5-4-6-8-11)15(19)17-16-18(2)13-9-23(20,21)10-14(13)22-16/h4-8,12-14H,3,9-10H2,1-2H3/b17-16-/t12-,13-,14-/m0/s1 |
| InChIKey | YCFKQMHGCGHCBD-ZWZWITGSSA-N |
| XLogP | 1.91 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|