C24H27N5O3S — CID 40919648
N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 40919648) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 40919648 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)Nc1ccc(-c3cn4ccsc4n3)cc1)C2=O |
| InChI | InChI=1S/C24H27N5O3S/c1-15-10-23(2,3)14-24(11-15)20(31)29(21(32)27-24)13-19(30)25-17-6-4-16(5-7-17)18-12-28-8-9-33-22(28)26-18/h4-9,12,15H,10-11,13-14H2,1-3H3,(H,25,30)(H,27,32)/t15-,24-/m1/s1 |
| InChIKey | LBUKFGTWQMUSOJ-OYLFLEFRSA-N |
| XLogP | 4.14 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|