C23H23NO3S2 — CID 40920119
N-[(3R)-1,1-dioxothiolan-3-yl]-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 40920119) has the molecular formula C23H23NO3S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 40920119 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N(Cc1cccs1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H23NO3S2/c25-23(22(18-8-3-1-4-9-18)19-10-5-2-6-11-19)24(16-21-12-7-14-28-21)20-13-15-29(26,27)17-20/h1-12,14,20,22H,13,15-17H2/t20-/m1/s1 |
| InChIKey | XABCXCULNWIETR-HXUWFJFHSA-N |
| XLogP | 4.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |