C14H15N7OS — CID 40920723
(3S)-1-(7H-purin-6-yl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 40920723) has the molecular formula C14H15N7OS and a molecular weight of 329.39 g/mol. Its IUPAC name is (3S)-1-(7H-purin-6-yl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(7H-purin-6-yl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40920723 |
| Molecular Formula | C14H15N7OS |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (3S)-1-(7H-purin-6-yl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@H]1CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C14H15N7OS/c22-13(20-14-15-3-5-23-14)9-2-1-4-21(6-9)12-10-11(17-7-16-10)18-8-19-12/h3,5,7-9H,1-2,4,6H2,(H,15,20,22)(H,16,17,18,19)/t9-/m0/s1 |
| InChIKey | XQLLAFRLPQWEKX-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |