C22H25N7O — CID 40826525
(3S)-N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]-1-(7H-purin-6-yl)piperidine-3-carboxamide (PubChem CID 40826525) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is (3S)-N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]-1-(7H-purin-6-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]-1-(7H-purin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40826525 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3S)-N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]-1-(7H-purin-6-yl)piperidine-3-carboxamide |
| SMILES | C[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H]1CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C22H25N7O/c1-14(9-16-10-23-18-7-3-2-6-17(16)18)28-22(30)15-5-4-8-29(11-15)21-19-20(25-12-24-19)26-13-27-21/h2-3,6-7,10,12-15,23H,4-5,8-9,11H2,1H3,(H,28,30)(H,24,25,26,27)/t14-,15-/m0/s1 |
| InChIKey | RQITUIITBXXSDS-GJZGRUSLSA-N |
| XLogP | 2.80 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |