C15H12BrN5O2S — CID 40930826
3-(2-bromophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 40930826) has the molecular formula C15H12BrN5O2S and a molecular weight of 406.27 g/mol. Its IUPAC name is 3-(2-bromophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-bromophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 40930826 |
| Molecular Formula | C15H12BrN5O2S |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 3-(2-bromophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1-c1ccccc1Br |
| InChI | InChI=1S/C15H12BrN5O2S/c16-13-4-2-1-3-12(13)14-18-19-15(20(14)17)24-9-10-5-7-11(8-6-10)21(22)23/h1-8H,9,17H2 |
| InChIKey | PCWWZYNIKFZMLI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|