C17H15BrN6O3S — CID 38864935
3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)propanamide (PubChem CID 38864935) has the molecular formula C17H15BrN6O3S and a molecular weight of 463.32 g/mol. Its IUPAC name is 3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)propanamide.
| Compound Name | 3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 38864935 |
| Molecular Formula | C17H15BrN6O3S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)propanamide |
| SMILES | Nn1c(SCCC(=O)Nc2ccc([N+](=O)[O-])cc2)nnc1-c1ccccc1Br |
| InChI | InChI=1S/C17H15BrN6O3S/c18-14-4-2-1-3-13(14)16-21-22-17(23(16)19)28-10-9-15(25)20-11-5-7-12(8-6-11)24(26)27/h1-8H,9-10,19H2,(H,20,25) |
| InChIKey | QXNGKFDHHRTTFP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|