C28H28ClN3O5 — CID 40941049
(5Z)-5-[[1-[2-[4-[(2S)-butan-2-yl]phenoxy]ethyl]pyrrol-2-yl]methylidene]-1-(3-chloro-4-methoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 40941049) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-[4-[(2S)-butan-2-yl]phenoxy]ethyl]pyrrol-2-yl]methylidene]-1-(3-chloro-4-methoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[1-[2-[4-[(2S)-butan-2-yl]phenoxy]ethyl]pyrrol-2-yl]methylidene]-1-(3-chloro-4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 40941049 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (5Z)-5-[[1-[2-[4-[(2S)-butan-2-yl]phenoxy]ethyl]pyrrol-2-yl]methylidene]-1-(3-chloro-4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC[C@H](C)c1ccc(OCCn2cccc2/C=C2/C(=O)NC(=O)N(c3ccc(OC)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H28ClN3O5/c1-4-18(2)19-7-10-22(11-8-19)37-15-14-31-13-5-6-20(31)16-23-26(33)30-28(35)32(27(23)34)21-9-12-25(36-3)24(29)17-21/h5-13,16-18H,4,14-15H2,1-3H3,(H,30,33,35)/b23-16-/t18-/m0/s1 |
| InChIKey | FDBJGAIOFFNWNY-PAJXCOJRSA-N |
| XLogP | 5.41 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|