C23H16Cl2FN3O4 — CID 5122501
5-[[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 5122501) has the molecular formula C23H16Cl2FN3O4 and a molecular weight of 488.30 g/mol. Its IUPAC name is 5-[[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5122501 |
| Molecular Formula | C23H16Cl2FN3O4 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 5-[[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(F)cc2)C(=O)C1=Cc1cccn1CCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H16Cl2FN3O4/c24-14-3-8-19(25)20(12-14)33-11-10-28-9-1-2-17(28)13-18-21(30)27-23(32)29(22(18)31)16-6-4-15(26)5-7-16/h1-9,12-13H,10-11H2,(H,27,30,32) |
| InChIKey | JRPDTQVWFFUDKZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|