C23H29ClN4O3 — CID 40947872
N'-(5-chloro-2-methoxyphenyl)-N-[(2R)-2-(dimethylamino)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]oxamide (PubChem CID 40947872) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-[(2R)-2-(dimethylamino)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-[(2R)-2-(dimethylamino)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 40947872 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-[(2R)-2-(dimethylamino)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NC[C@@H](c1ccc2c(c1)CCCN2C)N(C)C |
| InChI | InChI=1S/C23H29ClN4O3/c1-27(2)20(16-7-9-19-15(12-16)6-5-11-28(19)3)14-25-22(29)23(30)26-18-13-17(24)8-10-21(18)31-4/h7-10,12-13,20H,5-6,11,14H2,1-4H3,(H,25,29)(H,26,30)/t20-/m0/s1 |
| InChIKey | YZTBTQBLNRPFOR-FQEVSTJZSA-N |
| XLogP | 3.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|