C27H29ClN4O3S — CID 40951029
(6Z)-6-[[2-[2-[4-[(2S)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 40951029) has the molecular formula C27H29ClN4O3S and a molecular weight of 525.07 g/mol. Its IUPAC name is (6Z)-6-[[2-[2-[4-[(2S)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[2-[2-[4-[(2S)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 40951029 |
| Molecular Formula | C27H29ClN4O3S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | (6Z)-6-[[2-[2-[4-[(2S)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cc(Cl)ccc2OCCOc2ccc([C@@H](C)CC)cc2)/C(=O)N=C2SC(C(C)C)=NN2/1 |
| InChI | InChI=1S/C27H29ClN4O3S/c1-5-17(4)18-6-9-21(10-7-18)34-12-13-35-23-11-8-20(28)14-19(23)15-22-24(29)32-27(30-25(22)33)36-26(31-32)16(2)3/h6-11,14-17,29H,5,12-13H2,1-4H3/b22-15-,29-24-/t17-/m0/s1 |
| InChIKey | QZGGBGOIMCVCRP-REMUASCHSA-N |
| XLogP | 6.59 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|