C22H18ClFN4O2S — CID 4301821
6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4301821) has the molecular formula C22H18ClFN4O2S and a molecular weight of 456.93 g/mol. Its IUPAC name is 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4301821 |
| Molecular Formula | C22H18ClFN4O2S |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(Cl)ccc2OCc2ccc(F)cc2)C(=O)N=C2SC(C(C)C)=NN21 |
| InChI | InChI=1S/C22H18ClFN4O2S/c1-12(2)21-27-28-19(25)17(20(29)26-22(28)31-21)10-14-9-15(23)5-8-18(14)30-11-13-3-6-16(24)7-4-13/h3-10,12,25H,11H2,1-2H3/b17-10?,25-19+ |
| InChIKey | QUNOAHYQGFSJPM-WJPHPRNASA-N |
| XLogP | 5.33 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|