C21H22N4O4S2 — CID 40952344
(2R)-2-[4-amino-5-(benzenesulfonyl)pyrimidin-2-yl]sulfanyl-N-(4-methoxyphenyl)butanamide (PubChem CID 40952344) has the molecular formula C21H22N4O4S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is (2R)-2-[4-amino-5-(benzenesulfonyl)pyrimidin-2-yl]sulfanyl-N-(4-methoxyphenyl)butanamide.
| Compound Name | (2R)-2-[4-amino-5-(benzenesulfonyl)pyrimidin-2-yl]sulfanyl-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 40952344 |
| Molecular Formula | C21H22N4O4S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (2R)-2-[4-amino-5-(benzenesulfonyl)pyrimidin-2-yl]sulfanyl-N-(4-methoxyphenyl)butanamide |
| SMILES | CC[C@@H](Sc1ncc(S(=O)(=O)c2ccccc2)c(N)n1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H22N4O4S2/c1-3-17(20(26)24-14-9-11-15(29-2)12-10-14)30-21-23-13-18(19(22)25-21)31(27,28)16-7-5-4-6-8-16/h4-13,17H,3H2,1-2H3,(H,24,26)(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | BEAPJUYLTNNOLU-QGZVFWFLSA-N |
| XLogP | 3.41 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |