C18H22N4O4S — CID 50758202
ethyl 4-amino-2-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylpyrimidine-5-carboxylate (PubChem CID 50758202) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is ethyl 4-amino-2-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 50758202 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethyl 4-amino-2-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC(CC)C(=O)Nc2ccccc2OC)nc1N |
| InChI | InChI=1S/C18H22N4O4S/c1-4-14(16(23)21-12-8-6-7-9-13(12)25-3)27-18-20-10-11(15(19)22-18)17(24)26-5-2/h6-10,14H,4-5H2,1-3H3,(H,21,23)(H2,19,20,22) |
| InChIKey | OCQOIXCSGAMFQT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |