C15H13NO6S — CID 40952480
[(3R)-2-oxooxolan-3-yl] 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 40952480) has the molecular formula C15H13NO6S and a molecular weight of 335.34 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 40952480 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)O[C@@H]1CCOC1=O |
| InChI | InChI=1S/C15H13NO6S/c1-8-7-11(16-13(17)9-3-2-5-20-9)23-12(8)15(19)22-10-4-6-21-14(10)18/h2-3,5,7,10H,4,6H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | USJHOMVBRHLZEA-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |