C19H16N2O5S — CID 55495739
(2-amino-2-oxo-1-phenylethyl) 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 55495739) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55495739 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)OC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O5S/c1-11-10-14(21-18(23)13-8-5-9-25-13)27-16(11)19(24)26-15(17(20)22)12-6-3-2-4-7-12/h2-10,15H,1H3,(H2,20,22)(H,21,23) |
| InChIKey | MODRZZBEPCHODO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |