C20H16N4O4S — CID 35783708
(4-aminoquinazolin-2-yl)methyl 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 35783708) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 35783708 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 5-(furan-2-carbonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)OCc1nc(N)c2ccccc2n1 |
| InChI | InChI=1S/C20H16N4O4S/c1-11-9-16(24-19(25)14-7-4-8-27-14)29-17(11)20(26)28-10-15-22-13-6-3-2-5-12(13)18(21)23-15/h2-9H,10H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | OTUHKXQDZUYCKR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |