C20H23ClN3O3S+ — CID 4095316
4-(3-chlorophenyl)sulfanyl-N-[(2-ethylpyrrolidin-1-ium-1-yl)methyl]-3-nitrobenzamide (PubChem CID 4095316) has the molecular formula C20H23ClN3O3S+ and a molecular weight of 420.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfanyl-N-[(2-ethylpyrrolidin-1-ium-1-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-(3-chlorophenyl)sulfanyl-N-[(2-ethylpyrrolidin-1-ium-1-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4095316 |
| Molecular Formula | C20H23ClN3O3S+ |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-(3-chlorophenyl)sulfanyl-N-[(2-ethylpyrrolidin-1-ium-1-yl)methyl]-3-nitrobenzamide |
| SMILES | CCC1CCC[NH+]1CNC(=O)c1ccc(Sc2cccc(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-2-16-6-4-10-23(16)13-22-20(25)14-8-9-19(18(11-14)24(26)27)28-17-7-3-5-15(21)12-17/h3,5,7-9,11-12,16H,2,4,6,10,13H2,1H3,(H,22,25)/p+1 |
| InChIKey | SOMDZLGJUATFOI-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|