C15H21ClN4OS — CID 40953231
3-[[4-(4-chlorophenyl)-5-[(1S)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol (PubChem CID 40953231) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-5-[(1S)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[4-(4-chlorophenyl)-5-[(1S)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 40953231 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-5-[(1S)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
| SMILES | C[C@@H](c1nnc(SCCCO)n1-c1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C15H21ClN4OS/c1-11(19(2)3)14-17-18-15(22-10-4-9-21)20(14)13-7-5-12(16)6-8-13/h5-8,11,21H,4,9-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | XXQWMDXNXULXLH-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|