C16H15N3O3 — CID 40954212
(2R)-N-carbamoyl-2-(dibenzofuran-2-ylamino)propanamide (PubChem CID 40954212) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-(dibenzofuran-2-ylamino)propanamide.
| Compound Name | (2R)-N-carbamoyl-2-(dibenzofuran-2-ylamino)propanamide |
|---|---|
| PubChem CID | 40954212 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R)-N-carbamoyl-2-(dibenzofuran-2-ylamino)propanamide |
| SMILES | C[C@@H](Nc1ccc2oc3ccccc3c2c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H15N3O3/c1-9(15(20)19-16(17)21)18-10-6-7-14-12(8-10)11-4-2-3-5-13(11)22-14/h2-9,18H,1H3,(H3,17,19,20,21)/t9-/m1/s1 |
| InChIKey | VMQDXPVOQPAQNZ-SECBINFHSA-N |
| XLogP | 2.58 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |