C19H20N2O4S — CID 40954290
(2S)-2-(dibenzofuran-2-ylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 40954290) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2S)-2-(dibenzofuran-2-ylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | (2S)-2-(dibenzofuran-2-ylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 40954290 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2S)-2-(dibenzofuran-2-ylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | C[C@H](Nc1ccc2oc3ccccc3c2c1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20N2O4S/c1-12(19(22)21-14-8-9-26(23,24)11-14)20-13-6-7-18-16(10-13)15-4-2-3-5-17(15)25-18/h2-7,10,12,14,20H,8-9,11H2,1H3,(H,21,22)/t12-,14-/m0/s1 |
| InChIKey | ALZLSARPYVFQDW-JSGCOSHPSA-N |
| XLogP | 2.69 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |