C26H20N2O3S — CID 40954747
N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 40954747) has the molecular formula C26H20N2O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 40954747 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=O)c3ccc(-c4cc5ccccc5oc4=O)cc3)c2C#N)C1 |
| InChI | InChI=1S/C26H20N2O3S/c1-15-6-11-19-21(14-27)25(32-23(19)12-15)28-24(29)17-9-7-16(8-10-17)20-13-18-4-2-3-5-22(18)31-26(20)30/h2-5,7-10,13,15H,6,11-12H2,1H3,(H,28,29)/t15-/m1/s1 |
| InChIKey | UFFLWBZRTUICHD-OAHLLOKOSA-N |
| XLogP | 5.77 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|