C29H28N2O4S — CID 3950752
6-tert-butyl-2-[[4-(2-oxochromen-3-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3950752) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is 6-tert-butyl-2-[[4-(2-oxochromen-3-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[[4-(2-oxochromen-3-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3950752 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 6-tert-butyl-2-[[4-(2-oxochromen-3-yl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)c3ccc(-c4cc5ccccc5oc4=O)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C29H28N2O4S/c1-29(2,3)19-12-13-20-23(15-19)36-27(24(20)25(30)32)31-26(33)17-10-8-16(9-11-17)21-14-18-6-4-5-7-22(18)35-28(21)34/h4-11,14,19H,12-13,15H2,1-3H3,(H2,30,32)(H,31,33) |
| InChIKey | KAADLSWAWJDLKM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|