C14H19BrN2O4S — CID 40956375
1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide (PubChem CID 40956375) has the molecular formula C14H19BrN2O4S and a molecular weight of 391.29 g/mol. Its IUPAC name is 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide |
|---|---|
| PubChem CID | 40956375 |
| Molecular Formula | C14H19BrN2O4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide |
| SMILES | CCN1C(=O)C(C)(C)COc2cc(NS(=O)(=O)CBr)ccc21 |
| InChI | InChI=1S/C14H19BrN2O4S/c1-4-17-11-6-5-10(16-22(19,20)9-15)7-12(11)21-8-14(2,3)13(17)18/h5-7,16H,4,8-9H2,1-3H3 |
| InChIKey | VYIVTNGEYDGRJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|