About 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide
1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide (PubChem CID 40956375) has the molecular formula C14H19BrN2O4S
and a molecular weight of 391.29 g/mol. Its IUPAC name is 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide |
| PubChem CID | 40956375 |
| Molecular Formula | C14H19BrN2O4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide |
| SMILES | CCN1C(=O)C(C)(C)COc2cc(NS(=O)(=O)CBr)ccc21 |
| InChI | InChI=1S/C14H19BrN2O4S/c1-4-17-11-6-5-10(16-22(19,20)9-15)7-12(11)21-8-14(2,3)13(17)18/h5-7,16H,4,8-9H2,1-3H3 |
| InChIKey | VYIVTNGEYDGRJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide (CID 40956375) is 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide is CCN1C(=O)C(C)(C)COc2cc(NS(=O)(=O)CBr)ccc21.
What is the InChIKey of 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide?
The InChIKey is VYIVTNGEYDGRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O4S/c1-4-17-11-6-5-10(16-22(19,20)9-15)7-12(11)21-8-14(2,3)13(17)18/h5-7,16H,4,8-9H2,1-3H3.
What are the key properties of 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide?
1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide has a molecular weight of 391.29 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(5-ethyl-3,3-dimethyl-4-oxo-2H-1,5-benzoxazepin-8-yl)methanesulfonamide is sourced from PubChem (CID 40956375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).