C17H20N2O4 — CID 4095700
4-(2,5-dimethylanilino)-2-(furan-2-ylmethylamino)-4-oxobutanoic acid (PubChem CID 4095700) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(2,5-dimethylanilino)-2-(furan-2-ylmethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(2,5-dimethylanilino)-2-(furan-2-ylmethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4095700 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(2,5-dimethylanilino)-2-(furan-2-ylmethylamino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(C)c(NC(=O)CC(NCc2ccco2)C(=O)O)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-11-5-6-12(2)14(8-11)19-16(20)9-15(17(21)22)18-10-13-4-3-7-23-13/h3-8,15,18H,9-10H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | DQRKPBKMOORANT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |