C21H25N3O6S — CID 40958491
N-[3,3-dimethyl-5-(2-methylpropyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide (PubChem CID 40958491) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[3,3-dimethyl-5-(2-methylpropyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[3,3-dimethyl-5-(2-methylpropyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40958491 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[3,3-dimethyl-5-(2-methylpropyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)CN1C(=O)C(C)(C)COc2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C21H25N3O6S/c1-14(2)12-23-18-10-15(8-9-19(18)30-13-21(3,4)20(23)25)22-31(28,29)17-7-5-6-16(11-17)24(26)27/h5-11,14,22H,12-13H2,1-4H3 |
| InChIKey | NFSTUQWWSRRVMZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|