C22H27N3O6S — CID 40958950
N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide (PubChem CID 40958950) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40958950 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-7-yl]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)CCN1C(=O)C(C)(C)COc2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C22H27N3O6S/c1-15(2)10-11-24-19-12-16(8-9-20(19)31-14-22(3,4)21(24)26)23-32(29,30)18-7-5-6-17(13-18)25(27)28/h5-9,12-13,15,23H,10-11,14H2,1-4H3 |
| InChIKey | ZNAJTPPHUNQFDC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|