C25H25N3O2S — CID 4096211
N-(2-benzamido-1,3-benzothiazol-6-yl)adamantane-1-carboxamide (PubChem CID 4096211) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-(2-benzamido-1,3-benzothiazol-6-yl)adamantane-1-carboxamide.
| Compound Name | N-(2-benzamido-1,3-benzothiazol-6-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4096211 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-(2-benzamido-1,3-benzothiazol-6-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(NC(=O)C34CC5CC(CC(C5)C3)C4)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O2S/c29-22(18-4-2-1-3-5-18)28-24-27-20-7-6-19(11-21(20)31-24)26-23(30)25-12-15-8-16(13-25)10-17(9-15)14-25/h1-7,11,15-17H,8-10,12-14H2,(H,26,30)(H,27,28,29) |
| InChIKey | MVSSJPGNLQPWSW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |