C29H39NO4 — CID 40962551
(1R)-1-[(2R)-1,1,2,3,3,6-hexamethyl-2H-inden-5-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol (PubChem CID 40962551) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (1R)-1-[(2R)-1,1,2,3,3,6-hexamethyl-2H-inden-5-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol.
| Compound Name | (1R)-1-[(2R)-1,1,2,3,3,6-hexamethyl-2H-inden-5-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol |
|---|---|
| PubChem CID | 40962551 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (1R)-1-[(2R)-1,1,2,3,3,6-hexamethyl-2H-inden-5-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol |
| SMILES | COc1c2c(cc3c1[C@H](C[C@@H](O)c1cc4c(cc1C)C(C)(C)[C@@H](C)C4(C)C)N(C)CC3)OCO2 |
| InChI | InChI=1S/C29H39NO4/c1-16-11-20-21(29(5,6)17(2)28(20,3)4)13-19(16)23(31)14-22-25-18(9-10-30(22)7)12-24-26(27(25)32-8)34-15-33-24/h11-13,17,22-23,31H,9-10,14-15H2,1-8H3/t17-,22+,23-/m1/s1 |
| InChIKey | RXLGJHRPYZIAAS-MQNAVGNWSA-N |
| XLogP | 5.59 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |