C29H39NO4 — CID 51666826
(1S)-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol (PubChem CID 51666826) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (1S)-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol.
| Compound Name | (1S)-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol |
|---|---|
| PubChem CID | 51666826 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (1S)-1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethanol |
| SMILES | COc1c2c(cc3c1[C@H](C[C@H](O)c1cc(C(C)(C)C)cc4c1CCC4(C)C)N(C)CC3)OCO2 |
| InChI | InChI=1S/C29H39NO4/c1-28(2,3)18-13-20(19-8-10-29(4,5)21(19)14-18)23(31)15-22-25-17(9-11-30(22)6)12-24-26(27(25)32-7)34-16-33-24/h12-14,22-23,31H,8-11,15-16H2,1-7H3/t22-,23-/m0/s1 |
| InChIKey | XVPULKCGCVRRPV-GOTSBHOMSA-N |
| XLogP | 5.60 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |