C32H32N2O3 — CID 40966821
(2R)-N-(2,5-dimethylphenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]hexanamide (PubChem CID 40966821) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is (2R)-N-(2,5-dimethylphenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]hexanamide.
| Compound Name | (2R)-N-(2,5-dimethylphenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]hexanamide |
|---|---|
| PubChem CID | 40966821 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (2R)-N-(2,5-dimethylphenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]hexanamide |
| SMILES | CCCC[C@H](C(=O)Nc1cc(C)ccc1C)N1C(=O)[C@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C32H32N2O3/c1-4-5-14-25(30(35)33-24-17-18(2)15-16-19(24)3)34-31(36)28-26-20-10-6-7-11-21(20)27(29(28)32(34)37)23-13-9-8-12-22(23)26/h6-13,15-17,25-29H,4-5,14H2,1-3H3,(H,33,35)/t25-,26?,27?,28+,29+/m1/s1 |
| InChIKey | XPXYADZVDSSRNE-FEBWRTIQSA-N |
| XLogP | 5.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|