C29H24Cl2N2O3S — CID 98055908
(2R)-N-(3,4-dichlorophenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-4-methylsulfanylbutanamide (PubChem CID 98055908) has the molecular formula C29H24Cl2N2O3S and a molecular weight of 551.50 g/mol. Its IUPAC name is (2R)-N-(3,4-dichlorophenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-N-(3,4-dichlorophenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 98055908 |
| Molecular Formula | C29H24Cl2N2O3S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | (2R)-N-(3,4-dichlorophenyl)-2-[(15S,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](C(=O)Nc1ccc(Cl)c(Cl)c1)N1C(=O)[C@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C29H24Cl2N2O3S/c1-37-13-12-22(27(34)32-15-10-11-20(30)21(31)14-15)33-28(35)25-23-16-6-2-3-7-17(16)24(26(25)29(33)36)19-9-5-4-8-18(19)23/h2-11,14,22-26H,12-13H2,1H3,(H,32,34)/t22-,23?,24?,25+,26+/m1/s1 |
| InChIKey | VRGXHEMHSIXFJL-IOBSORRCSA-N |
| XLogP | 5.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|