C20H21ClN2O3S — CID 50740240
N-(4-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanylbutanamide (PubChem CID 50740240) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanylbutanamide.
| Compound Name | N-(4-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 50740240 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(C(=O)Nc1ccc(Cl)cc1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C20H21ClN2O3S/c1-27-9-8-15(18(24)22-14-6-4-13(21)5-7-14)23-19(25)16-11-2-3-12(10-11)17(16)20(23)26/h2-7,11-12,15-17H,8-10H2,1H3,(H,22,24) |
| InChIKey | UZZFOBZHJJQSEW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|